C26H37N4O13P — CID 42628618
(4S)-4-[[(2S)-2-acetamido-3-carboxypropanoyl]amino]-5-[[(2S)-1-[[(2S)-4-methyl-1-oxopentan-2-yl]amino]-1-oxo-3-(4-phosphonooxyphenyl)propan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 42628618) has the molecular formula C26H37N4O13P and a molecular weight of 644.57 g/mol. Its IUPAC name is (4S)-4-[[(2S)-2-acetamido-3-carboxypropanoyl]amino]-5-[[(2S)-1-[[(2S)-4-methyl-1-oxopentan-2-yl]amino]-1-oxo-3-(4-phosphonooxyphenyl)propan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | (4S)-4-[[(2S)-2-acetamido-3-carboxypropanoyl]amino]-5-[[(2S)-1-[[(2S)-4-methyl-1-oxopentan-2-yl]amino]-1-oxo-3-(4-phosphonooxyphenyl)propan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 42628618 |
| Molecular Formula | C26H37N4O13P |
| Molecular Weight | 644.57 g/mol |
| Exact Mass | 644.21 |
| IUPAC Name | (4S)-4-[[(2S)-2-acetamido-3-carboxypropanoyl]amino]-5-[[(2S)-1-[[(2S)-4-methyl-1-oxopentan-2-yl]amino]-1-oxo-3-(4-phosphonooxyphenyl)propan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | CC(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](Cc1ccc(OP(=O)(O)O)cc1)C(=O)N[C@H](C=O)CC(C)C |
| InChI | InChI=1S/C26H37N4O13P/c1-14(2)10-17(13-31)28-25(38)20(11-16-4-6-18(7-5-16)43-44(40,41)42)30-24(37)19(8-9-22(33)34)29-26(39)21(12-23(35)36)27-15(3)32/h4-7,13-14,17,19-21H,8-12H2,1-3H3,(H,27,32)(H,28,38)(H,29,39)(H,30,37)(H,33,34)(H,35,36)(H2,40,41,42)/t17-,19-,20-,21-/m0/s1 |
| InChIKey | KFNVKPPYQKHVSN-VMXMFDLUSA-N |
| XLogP | -0.76 |
| TPSA | 274.83 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.57 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|