C20H28N5O6P — CID 59980095
[4-[2-[(5-aminopyrazine-2-carbonyl)amino]-3-(4-methylpentan-2-ylamino)-3-oxopropyl]phenyl] dihydrogen phosphate (PubChem CID 59980095) has the molecular formula C20H28N5O6P and a molecular weight of 465.45 g/mol. Its IUPAC name is [4-[2-[(5-aminopyrazine-2-carbonyl)amino]-3-(4-methylpentan-2-ylamino)-3-oxopropyl]phenyl] dihydrogen phosphate.
| Compound Name | [4-[2-[(5-aminopyrazine-2-carbonyl)amino]-3-(4-methylpentan-2-ylamino)-3-oxopropyl]phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 59980095 |
| Molecular Formula | C20H28N5O6P |
| Molecular Weight | 465.45 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | [4-[2-[(5-aminopyrazine-2-carbonyl)amino]-3-(4-methylpentan-2-ylamino)-3-oxopropyl]phenyl] dihydrogen phosphate |
| SMILES | CC(C)CC(C)NC(=O)C(Cc1ccc(OP(=O)(O)O)cc1)NC(=O)c1cnc(N)cn1 |
| InChI | InChI=1S/C20H28N5O6P/c1-12(2)8-13(3)24-19(26)16(25-20(27)17-10-23-18(21)11-22-17)9-14-4-6-15(7-5-14)31-32(28,29)30/h4-7,10-13,16H,8-9H2,1-3H3,(H2,21,23)(H,24,26)(H,25,27)(H2,28,29,30) |
| InChIKey | XCONKLZUXFMUHD-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 176.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.45 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|