C11H17N3O6P+ — CID 102030186
[2-[[1-amino-1-oxo-3-(4-phosphonooxyphenyl)propan-2-yl]amino]-2-oxoethyl]azanium (PubChem CID 102030186) has the molecular formula C11H17N3O6P+ and a molecular weight of 318.25 g/mol. Its IUPAC name is [2-[[1-amino-1-oxo-3-(4-phosphonooxyphenyl)propan-2-yl]amino]-2-oxoethyl]azanium.
| Compound Name | [2-[[1-amino-1-oxo-3-(4-phosphonooxyphenyl)propan-2-yl]amino]-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 102030186 |
| Molecular Formula | C11H17N3O6P+ |
| Molecular Weight | 318.25 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | [2-[[1-amino-1-oxo-3-(4-phosphonooxyphenyl)propan-2-yl]amino]-2-oxoethyl]azanium |
| SMILES | NC(=O)C(Cc1ccc(OP(=O)(O)O)cc1)NC(=O)C[NH3+] |
| InChI | InChI=1S/C11H16N3O6P/c12-6-10(15)14-9(11(13)16)5-7-1-3-8(4-2-7)20-21(17,18)19/h1-4,9H,5-6,12H2,(H2,13,16)(H,14,15)(H2,17,18,19)/p+1 |
| InChIKey | KGTKUXLMBMVGCB-UHFFFAOYSA-O |
| XLogP | -2.09 |
| TPSA | 166.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.25 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|