C21H33N3O7P- — CID 170568944
[4-[3-[[(2S)-1-amino-3-methyl-1-oxopentan-2-yl]amino]-2-(hexanoylamino)-3-oxopropyl]phenyl] hydrogen phosphate (PubChem CID 170568944) has the molecular formula C21H33N3O7P- and a molecular weight of 470.48 g/mol. Its IUPAC name is [4-[3-[[(2S)-1-amino-3-methyl-1-oxopentan-2-yl]amino]-2-(hexanoylamino)-3-oxopropyl]phenyl] hydrogen phosphate.
| Compound Name | [4-[3-[[(2S)-1-amino-3-methyl-1-oxopentan-2-yl]amino]-2-(hexanoylamino)-3-oxopropyl]phenyl] hydrogen phosphate |
|---|---|
| PubChem CID | 170568944 |
| Molecular Formula | C21H33N3O7P- |
| Molecular Weight | 470.48 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | [4-[3-[[(2S)-1-amino-3-methyl-1-oxopentan-2-yl]amino]-2-(hexanoylamino)-3-oxopropyl]phenyl] hydrogen phosphate |
| SMILES | CCCCCC(=O)NC(Cc1ccc(OP(=O)([O-])O)cc1)C(=O)N[C@H](C(N)=O)C(C)CC |
| InChI | InChI=1S/C21H34N3O7P/c1-4-6-7-8-18(25)23-17(21(27)24-19(20(22)26)14(3)5-2)13-15-9-11-16(12-10-15)31-32(28,29)30/h9-12,14,17,19H,4-8,13H2,1-3H3,(H2,22,26)(H,23,25)(H,24,27)(H2,28,29,30)/p-1/t14?,17?,19-/m0/s1 |
| InChIKey | BSKKYDBEGRWWRC-YVNUBYTISA-M |
| XLogP | 1.15 |
| TPSA | 170.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.48 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|