C21H34N3O6P — CID 145413237
[4-[3-[(1-amino-3-methyl-1-oxopentan-2-yl)amino]-2-(hexanoylamino)-3-oxopropyl]phenyl] dihydrogen phosphite (PubChem CID 145413237) has the molecular formula C21H34N3O6P and a molecular weight of 455.49 g/mol. Its IUPAC name is [4-[3-[(1-amino-3-methyl-1-oxopentan-2-yl)amino]-2-(hexanoylamino)-3-oxopropyl]phenyl] dihydrogen phosphite.
| Compound Name | [4-[3-[(1-amino-3-methyl-1-oxopentan-2-yl)amino]-2-(hexanoylamino)-3-oxopropyl]phenyl] dihydrogen phosphite |
|---|---|
| PubChem CID | 145413237 |
| Molecular Formula | C21H34N3O6P |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | [4-[3-[(1-amino-3-methyl-1-oxopentan-2-yl)amino]-2-(hexanoylamino)-3-oxopropyl]phenyl] dihydrogen phosphite |
| SMILES | CCCCCC(=O)NC(Cc1ccc(OP(O)O)cc1)C(=O)NC(C(N)=O)C(C)CC |
| InChI | InChI=1S/C21H34N3O6P/c1-4-6-7-8-18(25)23-17(21(27)24-19(20(22)26)14(3)5-2)13-15-9-11-16(12-10-15)30-31(28)29/h9-12,14,17,19,28-29H,4-8,13H2,1-3H3,(H2,22,26)(H,23,25)(H,24,27) |
| InChIKey | YQBLTKMRVDSOIU-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 150.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|