C34H56N6O6 — CID 156688455
[4-[3-[[1-[(6-amino-6-oxohexyl)amino]-3-methyl-1-oxopentan-2-yl]amino]-2-(hexanoylamino)-3-oxopropyl]phenyl] 2-(4-methylpiperazin-1-yl)acetate (PubChem CID 156688455) has the molecular formula C34H56N6O6 and a molecular weight of 644.86 g/mol. Its IUPAC name is [4-[3-[[1-[(6-amino-6-oxohexyl)amino]-3-methyl-1-oxopentan-2-yl]amino]-2-(hexanoylamino)-3-oxopropyl]phenyl] 2-(4-methylpiperazin-1-yl)acetate.
| Compound Name | [4-[3-[[1-[(6-amino-6-oxohexyl)amino]-3-methyl-1-oxopentan-2-yl]amino]-2-(hexanoylamino)-3-oxopropyl]phenyl] 2-(4-methylpiperazin-1-yl)acetate |
|---|---|
| PubChem CID | 156688455 |
| Molecular Formula | C34H56N6O6 |
| Molecular Weight | 644.86 g/mol |
| Exact Mass | 644.43 |
| IUPAC Name | [4-[3-[[1-[(6-amino-6-oxohexyl)amino]-3-methyl-1-oxopentan-2-yl]amino]-2-(hexanoylamino)-3-oxopropyl]phenyl] 2-(4-methylpiperazin-1-yl)acetate |
| SMILES | CCCCCC(=O)NC(Cc1ccc(OC(=O)CN2CCN(C)CC2)cc1)C(=O)NC(C(=O)NCCCCCC(N)=O)C(C)CC |
| InChI | InChI=1S/C34H56N6O6/c1-5-7-9-13-30(42)37-28(33(44)38-32(25(3)6-2)34(45)36-18-11-8-10-12-29(35)41)23-26-14-16-27(17-15-26)46-31(43)24-40-21-19-39(4)20-22-40/h14-17,25,28,32H,5-13,18-24H2,1-4H3,(H2,35,41)(H,36,45)(H,37,42)(H,38,44) |
| InChIKey | OEZZFRNQVCIOIM-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 163.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.86 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|