C34H58N6O6 — CID 145413262
[4-[3-amino-2-(hexanoylamino)-3-oxopropyl]phenyl] 2-(4-methylpiperazin-1-yl)acetate;6-(3-methylpentanoylamino)hexanamide (PubChem CID 145413262) has the molecular formula C34H58N6O6 and a molecular weight of 646.87 g/mol. Its IUPAC name is [4-[3-amino-2-(hexanoylamino)-3-oxopropyl]phenyl] 2-(4-methylpiperazin-1-yl)acetate;6-(3-methylpentanoylamino)hexanamide.
| Compound Name | [4-[3-amino-2-(hexanoylamino)-3-oxopropyl]phenyl] 2-(4-methylpiperazin-1-yl)acetate;6-(3-methylpentanoylamino)hexanamide |
|---|---|
| PubChem CID | 145413262 |
| Molecular Formula | C34H58N6O6 |
| Molecular Weight | 646.87 g/mol |
| Exact Mass | 646.44 |
| IUPAC Name | [4-[3-amino-2-(hexanoylamino)-3-oxopropyl]phenyl] 2-(4-methylpiperazin-1-yl)acetate;6-(3-methylpentanoylamino)hexanamide |
| SMILES | CCC(C)CC(=O)NCCCCCC(N)=O.CCCCCC(=O)NC(Cc1ccc(OC(=O)CN2CCN(C)CC2)cc1)C(N)=O |
| InChI | InChI=1S/C22H34N4O4.C12H24N2O2/c1-3-4-5-6-20(27)24-19(22(23)29)15-17-7-9-18(10-8-17)30-21(28)16-26-13-11-25(2)12-14-26;1-3-10(2)9-12(16)14-8-6-4-5-7-11(13)15/h7-10,19H,3-6,11-16H2,1-2H3,(H2,23,29)(H,24,27);10H,3-9H2,1-2H3,(H2,13,15)(H,14,16) |
| InChIKey | CXIWWVVSVPGMLB-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 177.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.87 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|