C33H55N5O7 — CID 145413257
[4-[3-amino-2-(hexanoylamino)-3-oxopropyl]phenyl] 2-morpholin-4-ylacetate;6-(3-methylpentanoylamino)hexanamide (PubChem CID 145413257) has the molecular formula C33H55N5O7 and a molecular weight of 633.83 g/mol. Its IUPAC name is [4-[3-amino-2-(hexanoylamino)-3-oxopropyl]phenyl] 2-morpholin-4-ylacetate;6-(3-methylpentanoylamino)hexanamide.
| Compound Name | [4-[3-amino-2-(hexanoylamino)-3-oxopropyl]phenyl] 2-morpholin-4-ylacetate;6-(3-methylpentanoylamino)hexanamide |
|---|---|
| PubChem CID | 145413257 |
| Molecular Formula | C33H55N5O7 |
| Molecular Weight | 633.83 g/mol |
| Exact Mass | 633.41 |
| IUPAC Name | [4-[3-amino-2-(hexanoylamino)-3-oxopropyl]phenyl] 2-morpholin-4-ylacetate;6-(3-methylpentanoylamino)hexanamide |
| SMILES | CCC(C)CC(=O)NCCCCCC(N)=O.CCCCCC(=O)NC(Cc1ccc(OC(=O)CN2CCOCC2)cc1)C(N)=O |
| InChI | InChI=1S/C21H31N3O5.C12H24N2O2/c1-2-3-4-5-19(25)23-18(21(22)27)14-16-6-8-17(9-7-16)29-20(26)15-24-10-12-28-13-11-24;1-3-10(2)9-12(16)14-8-6-4-5-7-11(13)15/h6-9,18H,2-5,10-15H2,1H3,(H2,22,27)(H,23,25);10H,3-9H2,1-2H3,(H2,13,15)(H,14,16) |
| InChIKey | VFTKMFHCODZIPM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 183.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.83 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|