C29H46N4O6 — CID 171318009
[4-[(2S)-3-[[(2S,3S)-1-[(6-amino-6-oxohexyl)amino]-3-methyl-1-oxopentan-2-yl]amino]-2-(hexanoylamino)-3-oxopropyl]phenyl] acetate (PubChem CID 171318009) has the molecular formula C29H46N4O6 and a molecular weight of 546.71 g/mol. Its IUPAC name is [4-[(2S)-3-[[(2S,3S)-1-[(6-amino-6-oxohexyl)amino]-3-methyl-1-oxopentan-2-yl]amino]-2-(hexanoylamino)-3-oxopropyl]phenyl] acetate.
| Compound Name | [4-[(2S)-3-[[(2S,3S)-1-[(6-amino-6-oxohexyl)amino]-3-methyl-1-oxopentan-2-yl]amino]-2-(hexanoylamino)-3-oxopropyl]phenyl] acetate |
|---|---|
| PubChem CID | 171318009 |
| Molecular Formula | C29H46N4O6 |
| Molecular Weight | 546.71 g/mol |
| Exact Mass | 546.34 |
| IUPAC Name | [4-[(2S)-3-[[(2S,3S)-1-[(6-amino-6-oxohexyl)amino]-3-methyl-1-oxopentan-2-yl]amino]-2-(hexanoylamino)-3-oxopropyl]phenyl] acetate |
| SMILES | CCCCCC(=O)N[C@@H](Cc1ccc(OC(C)=O)cc1)C(=O)N[C@H](C(=O)NCCCCCC(N)=O)[C@@H](C)CC |
| InChI | InChI=1S/C29H46N4O6/c1-5-7-9-13-26(36)32-24(19-22-14-16-23(17-15-22)39-21(4)34)28(37)33-27(20(3)6-2)29(38)31-18-11-8-10-12-25(30)35/h14-17,20,24,27H,5-13,18-19H2,1-4H3,(H2,30,35)(H,31,38)(H,32,36)(H,33,37)/t20-,24-,27-/m0/s1 |
| InChIKey | MLJSAOBAOKWNQD-PPNCUWOSSA-N |
| XLogP | 2.91 |
| TPSA | 156.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.71 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|