C16H24N3O7PS — CID 10741438
[4-[(2S)-3-(2-acetamidoethylamino)-3-oxo-2-(3-sulfanylpropanoylamino)propyl]phenyl] dihydrogen phosphate (PubChem CID 10741438) has the molecular formula C16H24N3O7PS and a molecular weight of 433.42 g/mol. Its IUPAC name is [4-[(2S)-3-(2-acetamidoethylamino)-3-oxo-2-(3-sulfanylpropanoylamino)propyl]phenyl] dihydrogen phosphate.
| Compound Name | [4-[(2S)-3-(2-acetamidoethylamino)-3-oxo-2-(3-sulfanylpropanoylamino)propyl]phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 10741438 |
| Molecular Formula | C16H24N3O7PS |
| Molecular Weight | 433.42 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | [4-[(2S)-3-(2-acetamidoethylamino)-3-oxo-2-(3-sulfanylpropanoylamino)propyl]phenyl] dihydrogen phosphate |
| SMILES | CC(=O)NCCNC(=O)[C@H](Cc1ccc(OP(=O)(O)O)cc1)NC(=O)CCS |
| InChI | InChI=1S/C16H24N3O7PS/c1-11(20)17-7-8-18-16(22)14(19-15(21)6-9-28)10-12-2-4-13(5-3-12)26-27(23,24)25/h2-5,14,28H,6-10H2,1H3,(H,17,20)(H,18,22)(H,19,21)(H2,23,24,25)/t14-/m0/s1 |
| InChIKey | OTCPVKLMRITHJA-AWEZNQCLSA-N |
| XLogP | -0.24 |
| TPSA | 154.06 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.42 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|