C16H21N4O6P — CID 51002670
[4-[(2S)-2-acetamido-3-[2-(1H-imidazol-5-yl)ethylamino]-3-oxopropyl]phenyl] dihydrogen phosphate (PubChem CID 51002670) has the molecular formula C16H21N4O6P and a molecular weight of 396.34 g/mol. Its IUPAC name is [4-[(2S)-2-acetamido-3-[2-(1H-imidazol-5-yl)ethylamino]-3-oxopropyl]phenyl] dihydrogen phosphate.
| Compound Name | [4-[(2S)-2-acetamido-3-[2-(1H-imidazol-5-yl)ethylamino]-3-oxopropyl]phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 51002670 |
| Molecular Formula | C16H21N4O6P |
| Molecular Weight | 396.34 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | [4-[(2S)-2-acetamido-3-[2-(1H-imidazol-5-yl)ethylamino]-3-oxopropyl]phenyl] dihydrogen phosphate |
| SMILES | CC(=O)N[C@@H](Cc1ccc(OP(=O)(O)O)cc1)C(=O)NCCc1cnc[nH]1 |
| InChI | InChI=1S/C16H21N4O6P/c1-11(21)20-15(16(22)18-7-6-13-9-17-10-19-13)8-12-2-4-14(5-3-12)26-27(23,24)25/h2-5,9-10,15H,6-8H2,1H3,(H,17,19)(H,18,22)(H,20,21)(H2,23,24,25)/t15-/m0/s1 |
| InChIKey | QECFNYFOPBOKRA-HNNXBMFYSA-N |
| XLogP | 0.29 |
| TPSA | 153.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.34 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|