C11H16NO5PS — CID 101247885
[4-[2-(3-sulfanylpropanoylamino)ethyl]phenyl] dihydrogen phosphate (PubChem CID 101247885) has the molecular formula C11H16NO5PS and a molecular weight of 305.29 g/mol. Its IUPAC name is [4-[2-(3-sulfanylpropanoylamino)ethyl]phenyl] dihydrogen phosphate.
| Compound Name | [4-[2-(3-sulfanylpropanoylamino)ethyl]phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 101247885 |
| Molecular Formula | C11H16NO5PS |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | [4-[2-(3-sulfanylpropanoylamino)ethyl]phenyl] dihydrogen phosphate |
| SMILES | O=C(CCS)NCCc1ccc(OP(=O)(O)O)cc1 |
| InChI | InChI=1S/C11H16NO5PS/c13-11(6-8-19)12-7-5-9-1-3-10(4-2-9)17-18(14,15)16/h1-4,19H,5-8H2,(H,12,13)(H2,14,15,16) |
| InChIKey | XMYNOYYEOZWMSQ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|