C11H16NO3PS — CID 101210939
oxido-[4-[2-(3-sulfanylpropanoylamino)ethyl]phenoxy]phosphanium (PubChem CID 101210939) has the molecular formula C11H16NO3PS and a molecular weight of 273.29 g/mol. Its IUPAC name is oxido-[4-[2-(3-sulfanylpropanoylamino)ethyl]phenoxy]phosphanium.
| Compound Name | oxido-[4-[2-(3-sulfanylpropanoylamino)ethyl]phenoxy]phosphanium |
|---|---|
| PubChem CID | 101210939 |
| Molecular Formula | C11H16NO3PS |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | oxido-[4-[2-(3-sulfanylpropanoylamino)ethyl]phenoxy]phosphanium |
| SMILES | O=C(CCS)NCCc1ccc(O[PH2+][O-])cc1 |
| InChI | InChI=1S/C11H16NO3PS/c13-11(6-8-17)12-7-5-9-1-3-10(4-2-9)15-16-14/h1-4,17H,5-8,16H2,(H,12,13) |
| InChIKey | HUPVSZNAPYXDBM-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 61.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|