C13H19NO3S — CID 115168006
N-[2-(2,4-dimethoxyphenyl)ethyl]-3-sulfanylpropanamide (PubChem CID 115168006) has the molecular formula C13H19NO3S and a molecular weight of 269.37 g/mol. Its IUPAC name is N-[2-(2,4-dimethoxyphenyl)ethyl]-3-sulfanylpropanamide.
| Compound Name | N-[2-(2,4-dimethoxyphenyl)ethyl]-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 115168006 |
| Molecular Formula | C13H19NO3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | N-[2-(2,4-dimethoxyphenyl)ethyl]-3-sulfanylpropanamide |
| SMILES | COc1ccc(CCNC(=O)CCS)c(OC)c1 |
| InChI | InChI=1S/C13H19NO3S/c1-16-11-4-3-10(12(9-11)17-2)5-7-14-13(15)6-8-18/h3-4,9,18H,5-8H2,1-2H3,(H,14,15) |
| InChIKey | HUTSIQHUXZSJNB-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|