C14H21NO5S — CID 110607051
N-[2-(2,4-dimethoxyphenyl)ethyl]-3-methylsulfonylpropanamide (PubChem CID 110607051) has the molecular formula C14H21NO5S and a molecular weight of 315.39 g/mol. Its IUPAC name is N-[2-(2,4-dimethoxyphenyl)ethyl]-3-methylsulfonylpropanamide.
| Compound Name | N-[2-(2,4-dimethoxyphenyl)ethyl]-3-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 110607051 |
| Molecular Formula | C14H21NO5S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | N-[2-(2,4-dimethoxyphenyl)ethyl]-3-methylsulfonylpropanamide |
| SMILES | COc1ccc(CCNC(=O)CCS(C)(=O)=O)c(OC)c1 |
| InChI | InChI=1S/C14H21NO5S/c1-19-12-5-4-11(13(10-12)20-2)6-8-15-14(16)7-9-21(3,17)18/h4-5,10H,6-9H2,1-3H3,(H,15,16) |
| InChIKey | XZGJJNBWWOZWGX-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |