C13H21NO4S — CID 54905855
N-[(2,4-dimethoxyphenyl)methyl]-3-methylsulfonylpropan-1-amine (PubChem CID 54905855) has the molecular formula C13H21NO4S and a molecular weight of 287.38 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methyl]-3-methylsulfonylpropan-1-amine.
| Compound Name | N-[(2,4-dimethoxyphenyl)methyl]-3-methylsulfonylpropan-1-amine |
|---|---|
| PubChem CID | 54905855 |
| Molecular Formula | C13H21NO4S |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methyl]-3-methylsulfonylpropan-1-amine |
| SMILES | COc1ccc(CNCCCS(C)(=O)=O)c(OC)c1 |
| InChI | InChI=1S/C13H21NO4S/c1-17-12-6-5-11(13(9-12)18-2)10-14-7-4-8-19(3,15)16/h5-6,9,14H,4,7-8,10H2,1-3H3 |
| InChIKey | BIHWKNOZHHXARC-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|