C12H18FNO2 — CID 81105409
N-[(2,4-dimethoxyphenyl)methyl]-3-fluoropropan-1-amine (PubChem CID 81105409) has the molecular formula C12H18FNO2 and a molecular weight of 227.28 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methyl]-3-fluoropropan-1-amine.
| Compound Name | N-[(2,4-dimethoxyphenyl)methyl]-3-fluoropropan-1-amine |
|---|---|
| PubChem CID | 81105409 |
| Molecular Formula | C12H18FNO2 |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methyl]-3-fluoropropan-1-amine |
| SMILES | COc1ccc(CNCCCF)c(OC)c1 |
| InChI | InChI=1S/C12H18FNO2/c1-15-11-5-4-10(12(8-11)16-2)9-14-7-3-6-13/h4-5,8,14H,3,6-7,9H2,1-2H3 |
| InChIKey | BQEAZQQRDDHIBU-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|