C11H17NO2S — CID 115223928
2-[(2,4-dimethoxyphenyl)methylamino]ethanethiol (PubChem CID 115223928) has the molecular formula C11H17NO2S and a molecular weight of 227.33 g/mol. Its IUPAC name is 2-[(2,4-dimethoxyphenyl)methylamino]ethanethiol.
| Compound Name | 2-[(2,4-dimethoxyphenyl)methylamino]ethanethiol |
|---|---|
| PubChem CID | 115223928 |
| Molecular Formula | C11H17NO2S |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | 2-[(2,4-dimethoxyphenyl)methylamino]ethanethiol |
| SMILES | COc1ccc(CNCCS)c(OC)c1 |
| InChI | InChI=1S/C11H17NO2S/c1-13-10-4-3-9(8-12-5-6-15)11(7-10)14-2/h3-4,7,12,15H,5-6,8H2,1-2H3 |
| InChIKey | CRUXNLPVYHEWRD-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|