C13H19NO4 — CID 11844508
methyl 3-[(2,4-dimethoxyphenyl)methylamino]propanoate (PubChem CID 11844508) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is methyl 3-[(2,4-dimethoxyphenyl)methylamino]propanoate.
| Compound Name | methyl 3-[(2,4-dimethoxyphenyl)methylamino]propanoate |
|---|---|
| PubChem CID | 11844508 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | methyl 3-[(2,4-dimethoxyphenyl)methylamino]propanoate |
| SMILES | COC(=O)CCNCc1ccc(OC)cc1OC |
| InChI | InChI=1S/C13H19NO4/c1-16-11-5-4-10(12(8-11)17-2)9-14-7-6-13(15)18-3/h4-5,8,14H,6-7,9H2,1-3H3 |
| InChIKey | YTQUPBNQYZLYPX-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|