C14H24N2O2 — CID 17215620
N'-[(2,4-dimethoxyphenyl)methyl]-N-ethylpropane-1,3-diamine (PubChem CID 17215620) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is N'-[(2,4-dimethoxyphenyl)methyl]-N-ethylpropane-1,3-diamine.
| Compound Name | N'-[(2,4-dimethoxyphenyl)methyl]-N-ethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 17215620 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | N'-[(2,4-dimethoxyphenyl)methyl]-N-ethylpropane-1,3-diamine |
| SMILES | CCNCCCNCc1ccc(OC)cc1OC |
| InChI | InChI=1S/C14H24N2O2/c1-4-15-8-5-9-16-11-12-6-7-13(17-2)10-14(12)18-3/h6-7,10,15-16H,4-5,8-9,11H2,1-3H3 |
| InChIKey | POOKSFQOJLUVJO-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|