C20H23NO5 — CID 119182295
4-[3-[2-(2,4-dimethoxyphenyl)ethylamino]-3-oxopropyl]benzoic acid (PubChem CID 119182295) has the molecular formula C20H23NO5 and a molecular weight of 357.41 g/mol. Its IUPAC name is 4-[3-[2-(2,4-dimethoxyphenyl)ethylamino]-3-oxopropyl]benzoic acid.
| Compound Name | 4-[3-[2-(2,4-dimethoxyphenyl)ethylamino]-3-oxopropyl]benzoic acid |
|---|---|
| PubChem CID | 119182295 |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 4-[3-[2-(2,4-dimethoxyphenyl)ethylamino]-3-oxopropyl]benzoic acid |
| SMILES | COc1ccc(CCNC(=O)CCc2ccc(C(=O)O)cc2)c(OC)c1 |
| InChI | InChI=1S/C20H23NO5/c1-25-17-9-8-15(18(13-17)26-2)11-12-21-19(22)10-5-14-3-6-16(7-4-14)20(23)24/h3-4,6-9,13H,5,10-12H2,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | GSGQUODQGDWHCL-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |