C36H38N3O11P — CID 144944983
4-[2-[[2-[[(2S)-2-[(2-naphthalen-2-ylacetyl)amino]-3-phenylpropanoyl]amino]-3-(4-phosphonooxyphenyl)propanoyl]amino]ethoxy]-4-oxobutanoic acid (PubChem CID 144944983) has the molecular formula C36H38N3O11P and a molecular weight of 719.68 g/mol. Its IUPAC name is 4-[2-[[2-[[(2S)-2-[(2-naphthalen-2-ylacetyl)amino]-3-phenylpropanoyl]amino]-3-(4-phosphonooxyphenyl)propanoyl]amino]ethoxy]-4-oxobutanoic acid.
| Compound Name | 4-[2-[[2-[[(2S)-2-[(2-naphthalen-2-ylacetyl)amino]-3-phenylpropanoyl]amino]-3-(4-phosphonooxyphenyl)propanoyl]amino]ethoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 144944983 |
| Molecular Formula | C36H38N3O11P |
| Molecular Weight | 719.68 g/mol |
| Exact Mass | 719.22 |
| IUPAC Name | 4-[2-[[2-[[(2S)-2-[(2-naphthalen-2-ylacetyl)amino]-3-phenylpropanoyl]amino]-3-(4-phosphonooxyphenyl)propanoyl]amino]ethoxy]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)OCCNC(=O)C(Cc1ccc(OP(=O)(O)O)cc1)NC(=O)[C@H](Cc1ccccc1)NC(=O)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C36H38N3O11P/c40-32(23-26-10-13-27-8-4-5-9-28(27)20-26)38-31(21-24-6-2-1-3-7-24)36(45)39-30(22-25-11-14-29(15-12-25)50-51(46,47)48)35(44)37-18-19-49-34(43)17-16-33(41)42/h1-15,20,30-31H,16-19,21-23H2,(H,37,44)(H,38,40)(H,39,45)(H,41,42)(H2,46,47,48)/t30?,31-/m0/s1 |
| InChIKey | UGXFYCMTNYFZQX-FLDQDSGZSA-N |
| XLogP | 2.83 |
| TPSA | 217.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.68 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|