C33H48N3O9P — CID 10580224
(4S)-5-(dipentylamino)-5-oxo-4-[[(2S)-2-(3-phenylpropanoylamino)-3-(4-phosphonooxyphenyl)propanoyl]amino]pentanoic acid (PubChem CID 10580224) has the molecular formula C33H48N3O9P and a molecular weight of 661.73 g/mol. Its IUPAC name is (4S)-5-(dipentylamino)-5-oxo-4-[[(2S)-2-(3-phenylpropanoylamino)-3-(4-phosphonooxyphenyl)propanoyl]amino]pentanoic acid.
| Compound Name | (4S)-5-(dipentylamino)-5-oxo-4-[[(2S)-2-(3-phenylpropanoylamino)-3-(4-phosphonooxyphenyl)propanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 10580224 |
| Molecular Formula | C33H48N3O9P |
| Molecular Weight | 661.73 g/mol |
| Exact Mass | 661.31 |
| IUPAC Name | (4S)-5-(dipentylamino)-5-oxo-4-[[(2S)-2-(3-phenylpropanoylamino)-3-(4-phosphonooxyphenyl)propanoyl]amino]pentanoic acid |
| SMILES | CCCCCN(CCCCC)C(=O)[C@H](CCC(=O)O)NC(=O)[C@H](Cc1ccc(OP(=O)(O)O)cc1)NC(=O)CCc1ccccc1 |
| InChI | InChI=1S/C33H48N3O9P/c1-3-5-10-22-36(23-11-6-4-2)33(41)28(19-21-31(38)39)35-32(40)29(34-30(37)20-16-25-12-8-7-9-13-25)24-26-14-17-27(18-15-26)45-46(42,43)44/h7-9,12-15,17-18,28-29H,3-6,10-11,16,19-24H2,1-2H3,(H,34,37)(H,35,40)(H,38,39)(H2,42,43,44)/t28-,29-/m0/s1 |
| InChIKey | ODOAABFMSINLCP-VMPREFPWSA-N |
| XLogP | 4.38 |
| TPSA | 182.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.73 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|