C25H40F2N3O7P — CID 16740923
(4S)-4-[[(2S)-2-amino-3-[4-[difluoro(phosphono)methyl]phenyl]propanoyl]amino]-5-(dipentylamino)-5-oxopentanoic acid (PubChem CID 16740923) has the molecular formula C25H40F2N3O7P and a molecular weight of 563.58 g/mol. Its IUPAC name is (4S)-4-[[(2S)-2-amino-3-[4-[difluoro(phosphono)methyl]phenyl]propanoyl]amino]-5-(dipentylamino)-5-oxopentanoic acid.
| Compound Name | (4S)-4-[[(2S)-2-amino-3-[4-[difluoro(phosphono)methyl]phenyl]propanoyl]amino]-5-(dipentylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 16740923 |
| Molecular Formula | C25H40F2N3O7P |
| Molecular Weight | 563.58 g/mol |
| Exact Mass | 563.26 |
| IUPAC Name | (4S)-4-[[(2S)-2-amino-3-[4-[difluoro(phosphono)methyl]phenyl]propanoyl]amino]-5-(dipentylamino)-5-oxopentanoic acid |
| SMILES | CCCCCN(CCCCC)C(=O)[C@H](CCC(=O)O)NC(=O)[C@@H](N)Cc1ccc(C(F)(F)P(=O)(O)O)cc1 |
| InChI | InChI=1S/C25H40F2N3O7P/c1-3-5-7-15-30(16-8-6-4-2)24(34)21(13-14-22(31)32)29-23(33)20(28)17-18-9-11-19(12-10-18)25(26,27)38(35,36)37/h9-12,20-21H,3-8,13-17,28H2,1-2H3,(H,29,33)(H,31,32)(H2,35,36,37)/t20-,21-/m0/s1 |
| InChIKey | HARYQEYDRVWAMS-SFTDATJTSA-N |
| XLogP | 3.34 |
| TPSA | 170.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.58 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|