C27H30F4N3O10P — CID 18715491
5-[[1-[[1-amino-3-[4-[difluoro(phosphono)methyl]phenyl]-1-oxopropan-2-yl]amino]-3-[4-[carboxy(difluoro)methyl]phenyl]-1-oxopropan-2-yl]amino]-4-methyl-5-oxopentanoic acid (PubChem CID 18715491) has the molecular formula C27H30F4N3O10P and a molecular weight of 663.51 g/mol. Its IUPAC name is 5-[[1-[[1-amino-3-[4-[difluoro(phosphono)methyl]phenyl]-1-oxopropan-2-yl]amino]-3-[4-[carboxy(difluoro)methyl]phenyl]-1-oxopropan-2-yl]amino]-4-methyl-5-oxopentanoic acid.
| Compound Name | 5-[[1-[[1-amino-3-[4-[difluoro(phosphono)methyl]phenyl]-1-oxopropan-2-yl]amino]-3-[4-[carboxy(difluoro)methyl]phenyl]-1-oxopropan-2-yl]amino]-4-methyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18715491 |
| Molecular Formula | C27H30F4N3O10P |
| Molecular Weight | 663.51 g/mol |
| Exact Mass | 663.16 |
| IUPAC Name | 5-[[1-[[1-amino-3-[4-[difluoro(phosphono)methyl]phenyl]-1-oxopropan-2-yl]amino]-3-[4-[carboxy(difluoro)methyl]phenyl]-1-oxopropan-2-yl]amino]-4-methyl-5-oxopentanoic acid |
| SMILES | CC(CCC(=O)O)C(=O)NC(Cc1ccc(C(F)(F)C(=O)O)cc1)C(=O)NC(Cc1ccc(C(F)(F)P(=O)(O)O)cc1)C(N)=O |
| InChI | InChI=1S/C27H30F4N3O10P/c1-14(2-11-21(35)36)23(38)34-20(13-16-3-7-17(8-4-16)26(28,29)25(40)41)24(39)33-19(22(32)37)12-15-5-9-18(10-6-15)27(30,31)45(42,43)44/h3-10,14,19-20H,2,11-13H2,1H3,(H2,32,37)(H,33,39)(H,34,38)(H,35,36)(H,40,41)(H2,42,43,44) |
| InChIKey | BDBYMYZEFZHWMM-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 233.42 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.51 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|