C21H30F2N3O7P — CID 149354226
[[4-[2-[(6-acetamido-1-amino-1-oxohexan-2-yl)carbamoyl]-4-oxopentyl]phenyl]-difluoromethyl]phosphonic acid (PubChem CID 149354226) has the molecular formula C21H30F2N3O7P and a molecular weight of 505.46 g/mol. Its IUPAC name is [[4-[2-[(6-acetamido-1-amino-1-oxohexan-2-yl)carbamoyl]-4-oxopentyl]phenyl]-difluoromethyl]phosphonic acid.
| Compound Name | [[4-[2-[(6-acetamido-1-amino-1-oxohexan-2-yl)carbamoyl]-4-oxopentyl]phenyl]-difluoromethyl]phosphonic acid |
|---|---|
| PubChem CID | 149354226 |
| Molecular Formula | C21H30F2N3O7P |
| Molecular Weight | 505.46 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | [[4-[2-[(6-acetamido-1-amino-1-oxohexan-2-yl)carbamoyl]-4-oxopentyl]phenyl]-difluoromethyl]phosphonic acid |
| SMILES | CC(=O)CC(Cc1ccc(C(F)(F)P(=O)(O)O)cc1)C(=O)NC(CCCCNC(C)=O)C(N)=O |
| InChI | InChI=1S/C21H30F2N3O7P/c1-13(27)11-16(12-15-6-8-17(9-7-15)21(22,23)34(31,32)33)20(30)26-18(19(24)29)5-3-4-10-25-14(2)28/h6-9,16,18H,3-5,10-12H2,1-2H3,(H2,24,29)(H,25,28)(H,26,30)(H2,31,32,33) |
| InChIKey | YGPUFNQIKKZCSF-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 175.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.46 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|