C33H41N5O4 — CID 70293680
(2S)-6-acetamido-2-[[(2R)-2-[[(2R)-2-amino-3-(4-phenylphenyl)propanoyl]-methylamino]-3-phenylpropanoyl]amino]hexanamide (PubChem CID 70293680) has the molecular formula C33H41N5O4 and a molecular weight of 571.72 g/mol. Its IUPAC name is (2S)-6-acetamido-2-[[(2R)-2-[[(2R)-2-amino-3-(4-phenylphenyl)propanoyl]-methylamino]-3-phenylpropanoyl]amino]hexanamide.
| Compound Name | (2S)-6-acetamido-2-[[(2R)-2-[[(2R)-2-amino-3-(4-phenylphenyl)propanoyl]-methylamino]-3-phenylpropanoyl]amino]hexanamide |
|---|---|
| PubChem CID | 70293680 |
| Molecular Formula | C33H41N5O4 |
| Molecular Weight | 571.72 g/mol |
| Exact Mass | 571.32 |
| IUPAC Name | (2S)-6-acetamido-2-[[(2R)-2-[[(2R)-2-amino-3-(4-phenylphenyl)propanoyl]-methylamino]-3-phenylpropanoyl]amino]hexanamide |
| SMILES | CC(=O)NCCCC[C@H](NC(=O)[C@@H](Cc1ccccc1)N(C)C(=O)[C@H](N)Cc1ccc(-c2ccccc2)cc1)C(N)=O |
| InChI | InChI=1S/C33H41N5O4/c1-23(39)36-20-10-9-15-29(31(35)40)37-32(41)30(22-24-11-5-3-6-12-24)38(2)33(42)28(34)21-25-16-18-27(19-17-25)26-13-7-4-8-14-26/h3-8,11-14,16-19,28-30H,9-10,15,20-22,34H2,1-2H3,(H2,35,40)(H,36,39)(H,37,41)/t28-,29+,30-/m1/s1 |
| InChIKey | NHDUFBIZOGEGHQ-DYIKCSJPSA-N |
| XLogP | 2.57 |
| TPSA | 147.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.72 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|