C28H38N4O4 — CID 170598416
(2S)-N-[(2S)-1-[[(3S)-6-(carbamoylamino)-2-oxohexan-3-yl]amino]-1-oxo-3-(4-phenylphenyl)propan-2-yl]-2,3-dimethylbutanamide (PubChem CID 170598416) has the molecular formula C28H38N4O4 and a molecular weight of 494.64 g/mol. Its IUPAC name is (2S)-N-[(2S)-1-[[(3S)-6-(carbamoylamino)-2-oxohexan-3-yl]amino]-1-oxo-3-(4-phenylphenyl)propan-2-yl]-2,3-dimethylbutanamide.
| Compound Name | (2S)-N-[(2S)-1-[[(3S)-6-(carbamoylamino)-2-oxohexan-3-yl]amino]-1-oxo-3-(4-phenylphenyl)propan-2-yl]-2,3-dimethylbutanamide |
|---|---|
| PubChem CID | 170598416 |
| Molecular Formula | C28H38N4O4 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.29 |
| IUPAC Name | (2S)-N-[(2S)-1-[[(3S)-6-(carbamoylamino)-2-oxohexan-3-yl]amino]-1-oxo-3-(4-phenylphenyl)propan-2-yl]-2,3-dimethylbutanamide |
| SMILES | CC(=O)[C@H](CCCNC(N)=O)NC(=O)[C@H](Cc1ccc(-c2ccccc2)cc1)NC(=O)[C@@H](C)C(C)C |
| InChI | InChI=1S/C28H38N4O4/c1-18(2)19(3)26(34)32-25(27(35)31-24(20(4)33)11-8-16-30-28(29)36)17-21-12-14-23(15-13-21)22-9-6-5-7-10-22/h5-7,9-10,12-15,18-19,24-25H,8,11,16-17H2,1-4H3,(H,31,35)(H,32,34)(H3,29,30,36)/t19-,24-,25-/m0/s1 |
| InChIKey | DUQIZMMZNMWVDH-LQGLAIQGSA-N |
| XLogP | 3.20 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|