C26H34N4O5 — CID 58789915
5-[[(2R)-1-[[(2R)-1,6-diamino-1-oxohexan-2-yl]amino]-1-oxo-3-(4-phenylphenyl)propan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 58789915) has the molecular formula C26H34N4O5 and a molecular weight of 482.58 g/mol. Its IUPAC name is 5-[[(2R)-1-[[(2R)-1,6-diamino-1-oxohexan-2-yl]amino]-1-oxo-3-(4-phenylphenyl)propan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | 5-[[(2R)-1-[[(2R)-1,6-diamino-1-oxohexan-2-yl]amino]-1-oxo-3-(4-phenylphenyl)propan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 58789915 |
| Molecular Formula | C26H34N4O5 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | 5-[[(2R)-1-[[(2R)-1,6-diamino-1-oxohexan-2-yl]amino]-1-oxo-3-(4-phenylphenyl)propan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | NCCCC[C@@H](NC(=O)[C@@H](Cc1ccc(-c2ccccc2)cc1)NC(=O)CCCC(=O)O)C(N)=O |
| InChI | InChI=1S/C26H34N4O5/c27-16-5-4-9-21(25(28)34)30-26(35)22(29-23(31)10-6-11-24(32)33)17-18-12-14-20(15-13-18)19-7-2-1-3-8-19/h1-3,7-8,12-15,21-22H,4-6,9-11,16-17,27H2,(H2,28,34)(H,29,31)(H,30,35)(H,32,33)/t21-,22-/m1/s1 |
| InChIKey | YPTQZTRDVQQAFV-FGZHOGPDSA-N |
| XLogP | 1.73 |
| TPSA | 164.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|