C22H23F5N4O3 — CID 71613099
N-[(2S)-1-[[(2S)-1,6-diamino-1-oxohexan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]-2,3,4,5,6-pentafluorobenzamide (PubChem CID 71613099) has the molecular formula C22H23F5N4O3 and a molecular weight of 486.44 g/mol. Its IUPAC name is N-[(2S)-1-[[(2S)-1,6-diamino-1-oxohexan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]-2,3,4,5,6-pentafluorobenzamide.
| Compound Name | N-[(2S)-1-[[(2S)-1,6-diamino-1-oxohexan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]-2,3,4,5,6-pentafluorobenzamide |
|---|---|
| PubChem CID | 71613099 |
| Molecular Formula | C22H23F5N4O3 |
| Molecular Weight | 486.44 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | N-[(2S)-1-[[(2S)-1,6-diamino-1-oxohexan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]-2,3,4,5,6-pentafluorobenzamide |
| SMILES | NCCCC[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)c1c(F)c(F)c(F)c(F)c1F)C(N)=O |
| InChI | InChI=1S/C22H23F5N4O3/c23-15-14(16(24)18(26)19(27)17(15)25)22(34)31-13(10-11-6-2-1-3-7-11)21(33)30-12(20(29)32)8-4-5-9-28/h1-3,6-7,12-13H,4-5,8-10,28H2,(H2,29,32)(H,30,33)(H,31,34)/t12-,13-/m0/s1 |
| InChIKey | KLCXUSDJIGQTOX-STQMWFEESA-N |
| XLogP | 1.82 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.44 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|