C32H40N6O5 — CID 66553879
(2S)-6-amino-2-[[(2S)-2-[[(2S)-3-phenyl-2-[[(2S)-3-phenyl-2-(prop-2-enoylamino)propanoyl]amino]propanoyl]amino]pent-4-ynoyl]amino]hexanamide (PubChem CID 66553879) has the molecular formula C32H40N6O5 and a molecular weight of 588.71 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2S)-2-[[(2S)-3-phenyl-2-[[(2S)-3-phenyl-2-(prop-2-enoylamino)propanoyl]amino]propanoyl]amino]pent-4-ynoyl]amino]hexanamide.
| Compound Name | (2S)-6-amino-2-[[(2S)-2-[[(2S)-3-phenyl-2-[[(2S)-3-phenyl-2-(prop-2-enoylamino)propanoyl]amino]propanoyl]amino]pent-4-ynoyl]amino]hexanamide |
|---|---|
| PubChem CID | 66553879 |
| Molecular Formula | C32H40N6O5 |
| Molecular Weight | 588.71 g/mol |
| Exact Mass | 588.31 |
| IUPAC Name | (2S)-6-amino-2-[[(2S)-2-[[(2S)-3-phenyl-2-[[(2S)-3-phenyl-2-(prop-2-enoylamino)propanoyl]amino]propanoyl]amino]pent-4-ynoyl]amino]hexanamide |
| SMILES | C#CC[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](Cc1ccccc1)NC(=O)C=C)C(=O)N[C@@H](CCCCN)C(N)=O |
| InChI | InChI=1S/C32H40N6O5/c1-3-13-25(30(41)36-24(29(34)40)18-11-12-19-33)37-32(43)27(21-23-16-9-6-10-17-23)38-31(42)26(35-28(39)4-2)20-22-14-7-5-8-15-22/h1,4-10,14-17,24-27H,2,11-13,18-21,33H2,(H2,34,40)(H,35,39)(H,36,41)(H,37,43)(H,38,42)/t24-,25-,26-,27-/m0/s1 |
| InChIKey | BZPQKTWXTNEPLZ-FWEHEUNISA-N |
| XLogP | 0.23 |
| TPSA | 185.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.71 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|