C17H26N4O3 — CID 23276388
2-[(2-acetamido-3-phenylpropanoyl)amino]-6-aminohexanamide (PubChem CID 23276388) has the molecular formula C17H26N4O3 and a molecular weight of 334.42 g/mol. Its IUPAC name is 2-[(2-acetamido-3-phenylpropanoyl)amino]-6-aminohexanamide.
| Compound Name | 2-[(2-acetamido-3-phenylpropanoyl)amino]-6-aminohexanamide |
|---|---|
| PubChem CID | 23276388 |
| Molecular Formula | C17H26N4O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 2-[(2-acetamido-3-phenylpropanoyl)amino]-6-aminohexanamide |
| SMILES | CC(=O)NC(Cc1ccccc1)C(=O)NC(CCCCN)C(N)=O |
| InChI | InChI=1S/C17H26N4O3/c1-12(22)20-15(11-13-7-3-2-4-8-13)17(24)21-14(16(19)23)9-5-6-10-18/h2-4,7-8,14-15H,5-6,9-11,18H2,1H3,(H2,19,23)(H,20,22)(H,21,24) |
| InChIKey | KHLCZZFKCNCKJQ-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|