C31H34N4O3 — CID 89061601
(2S)-2-[[(2S)-2-acetamido-3-(4-anthracen-9-ylphenyl)propanoyl]amino]-6-aminohexanamide (PubChem CID 89061601) has the molecular formula C31H34N4O3 and a molecular weight of 510.64 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-acetamido-3-(4-anthracen-9-ylphenyl)propanoyl]amino]-6-aminohexanamide.
| Compound Name | (2S)-2-[[(2S)-2-acetamido-3-(4-anthracen-9-ylphenyl)propanoyl]amino]-6-aminohexanamide |
|---|---|
| PubChem CID | 89061601 |
| Molecular Formula | C31H34N4O3 |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.26 |
| IUPAC Name | (2S)-2-[[(2S)-2-acetamido-3-(4-anthracen-9-ylphenyl)propanoyl]amino]-6-aminohexanamide |
| SMILES | CC(=O)N[C@@H](Cc1ccc(-c2c3ccccc3cc3ccccc23)cc1)C(=O)N[C@@H](CCCCN)C(N)=O |
| InChI | InChI=1S/C31H34N4O3/c1-20(36)34-28(31(38)35-27(30(33)37)12-6-7-17-32)18-21-13-15-22(16-14-21)29-25-10-4-2-8-23(25)19-24-9-3-5-11-26(24)29/h2-5,8-11,13-16,19,27-28H,6-7,12,17-18,32H2,1H3,(H2,33,37)(H,34,36)(H,35,38)/t27-,28-/m0/s1 |
| InChIKey | BFNYLPJCSUJBGG-NSOVKSMOSA-N |
| XLogP | 3.81 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|