C29H36N6O4S — CID 167151318
6-amino-2-[[(2R)-2-[[2-[(2-naphthalen-2-ylacetyl)amino]-3-pyridin-4-ylpropanoyl]amino]-3-sulfanylpropanoyl]amino]hexanamide (PubChem CID 167151318) has the molecular formula C29H36N6O4S and a molecular weight of 564.71 g/mol. Its IUPAC name is 6-amino-2-[[(2R)-2-[[2-[(2-naphthalen-2-ylacetyl)amino]-3-pyridin-4-ylpropanoyl]amino]-3-sulfanylpropanoyl]amino]hexanamide.
| Compound Name | 6-amino-2-[[(2R)-2-[[2-[(2-naphthalen-2-ylacetyl)amino]-3-pyridin-4-ylpropanoyl]amino]-3-sulfanylpropanoyl]amino]hexanamide |
|---|---|
| PubChem CID | 167151318 |
| Molecular Formula | C29H36N6O4S |
| Molecular Weight | 564.71 g/mol |
| Exact Mass | 564.25 |
| IUPAC Name | 6-amino-2-[[(2R)-2-[[2-[(2-naphthalen-2-ylacetyl)amino]-3-pyridin-4-ylpropanoyl]amino]-3-sulfanylpropanoyl]amino]hexanamide |
| SMILES | NCCCCC(NC(=O)[C@H](CS)NC(=O)C(Cc1ccncc1)NC(=O)Cc1ccc2ccccc2c1)C(N)=O |
| InChI | InChI=1S/C29H36N6O4S/c30-12-4-3-7-23(27(31)37)34-29(39)25(18-40)35-28(38)24(16-19-10-13-32-14-11-19)33-26(36)17-20-8-9-21-5-1-2-6-22(21)15-20/h1-2,5-6,8-11,13-15,23-25,40H,3-4,7,12,16-18,30H2,(H2,31,37)(H,33,36)(H,34,39)(H,35,38)/t23?,24?,25-/m0/s1 |
| InChIKey | BHXOWQOWCHDYGK-STEQJIOHSA-N |
| XLogP | 1.02 |
| TPSA | 169.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.71 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|