C36H49N7O5 — CID 163928544
(2S)-6-amino-2-[[2-[[(2R)-2-[[2-[4-(methylamino)butanoylamino]-3-naphthalen-2-ylpropanoyl]amino]propanoyl]amino]-3-phenylpropanoyl]amino]hexanamide (PubChem CID 163928544) has the molecular formula C36H49N7O5 and a molecular weight of 659.83 g/mol. Its IUPAC name is (2S)-6-amino-2-[[2-[[(2R)-2-[[2-[4-(methylamino)butanoylamino]-3-naphthalen-2-ylpropanoyl]amino]propanoyl]amino]-3-phenylpropanoyl]amino]hexanamide.
| Compound Name | (2S)-6-amino-2-[[2-[[(2R)-2-[[2-[4-(methylamino)butanoylamino]-3-naphthalen-2-ylpropanoyl]amino]propanoyl]amino]-3-phenylpropanoyl]amino]hexanamide |
|---|---|
| PubChem CID | 163928544 |
| Molecular Formula | C36H49N7O5 |
| Molecular Weight | 659.83 g/mol |
| Exact Mass | 659.38 |
| IUPAC Name | (2S)-6-amino-2-[[2-[[(2R)-2-[[2-[4-(methylamino)butanoylamino]-3-naphthalen-2-ylpropanoyl]amino]propanoyl]amino]-3-phenylpropanoyl]amino]hexanamide |
| SMILES | CNCCCC(=O)NC(Cc1ccc2ccccc2c1)C(=O)N[C@H](C)C(=O)NC(Cc1ccccc1)C(=O)N[C@@H](CCCCN)C(N)=O |
| InChI | InChI=1S/C36H49N7O5/c1-24(34(46)43-31(22-25-11-4-3-5-12-25)36(48)42-29(33(38)45)15-8-9-19-37)40-35(47)30(41-32(44)16-10-20-39-2)23-26-17-18-27-13-6-7-14-28(27)21-26/h3-7,11-14,17-18,21,24,29-31,39H,8-10,15-16,19-20,22-23,37H2,1-2H3,(H2,38,45)(H,40,47)(H,41,44)(H,42,48)(H,43,46)/t24-,29+,30?,31?/m1/s1 |
| InChIKey | RGQMSJAINOBJTD-XOPJSNJVSA-N |
| XLogP | 1.20 |
| TPSA | 197.54 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.83 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|