C40H44N4O3 — CID 59081911
(2R)-7-amino-N-[(2R)-1-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]amino]-3-naphthalen-2-yl-1-oxopropan-2-yl]-2-(naphthalen-2-ylmethyl)heptanamide (PubChem CID 59081911) has the molecular formula C40H44N4O3 and a molecular weight of 628.82 g/mol. Its IUPAC name is (2R)-7-amino-N-[(2R)-1-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]amino]-3-naphthalen-2-yl-1-oxopropan-2-yl]-2-(naphthalen-2-ylmethyl)heptanamide.
| Compound Name | (2R)-7-amino-N-[(2R)-1-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]amino]-3-naphthalen-2-yl-1-oxopropan-2-yl]-2-(naphthalen-2-ylmethyl)heptanamide |
|---|---|
| PubChem CID | 59081911 |
| Molecular Formula | C40H44N4O3 |
| Molecular Weight | 628.82 g/mol |
| Exact Mass | 628.34 |
| IUPAC Name | (2R)-7-amino-N-[(2R)-1-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]amino]-3-naphthalen-2-yl-1-oxopropan-2-yl]-2-(naphthalen-2-ylmethyl)heptanamide |
| SMILES | NCCCCC[C@H](Cc1ccc2ccccc2c1)C(=O)N[C@H](Cc1ccc2ccccc2c1)C(=O)N[C@@H](Cc1ccccc1)C(N)=O |
| InChI | InChI=1S/C40H44N4O3/c41-22-10-2-5-17-35(25-29-18-20-31-13-6-8-15-33(31)23-29)39(46)44-37(27-30-19-21-32-14-7-9-16-34(32)24-30)40(47)43-36(38(42)45)26-28-11-3-1-4-12-28/h1,3-4,6-9,11-16,18-21,23-24,35-37H,2,5,10,17,22,25-27,41H2,(H2,42,45)(H,43,47)(H,44,46)/t35-,36+,37-/m1/s1 |
| InChIKey | MKUFCRIOQQNWKY-HPJTWKJOSA-N |
| XLogP | 5.61 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.82 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|