C30H33N3O3 — CID 59081934
(2R)-N-[(2S)-1-(3-aminopropylamino)-3-naphthalen-2-yl-1-oxopropan-2-yl]-2-(hydroxymethyl)-3-naphthalen-2-ylpropanamide (PubChem CID 59081934) has the molecular formula C30H33N3O3 and a molecular weight of 483.61 g/mol. Its IUPAC name is (2R)-N-[(2S)-1-(3-aminopropylamino)-3-naphthalen-2-yl-1-oxopropan-2-yl]-2-(hydroxymethyl)-3-naphthalen-2-ylpropanamide.
| Compound Name | (2R)-N-[(2S)-1-(3-aminopropylamino)-3-naphthalen-2-yl-1-oxopropan-2-yl]-2-(hydroxymethyl)-3-naphthalen-2-ylpropanamide |
|---|---|
| PubChem CID | 59081934 |
| Molecular Formula | C30H33N3O3 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.25 |
| IUPAC Name | (2R)-N-[(2S)-1-(3-aminopropylamino)-3-naphthalen-2-yl-1-oxopropan-2-yl]-2-(hydroxymethyl)-3-naphthalen-2-ylpropanamide |
| SMILES | NCCCNC(=O)[C@H](Cc1ccc2ccccc2c1)NC(=O)[C@@H](CO)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C30H33N3O3/c31-14-5-15-32-30(36)28(19-22-11-13-24-7-2-4-9-26(24)17-22)33-29(35)27(20-34)18-21-10-12-23-6-1-3-8-25(23)16-21/h1-4,6-13,16-17,27-28,34H,5,14-15,18-20,31H2,(H,32,36)(H,33,35)/t27-,28+/m1/s1 |
| InChIKey | KMQMQBPFFNLQTA-IZLXSDGUSA-N |
| XLogP | 3.34 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|