C29H34N2O4 — CID 69486465
(3R)-3-[[(2S)-1-(benzylamino)-3-naphthalen-2-yl-1-oxopropan-2-yl]carbamoyl]octanoic acid (PubChem CID 69486465) has the molecular formula C29H34N2O4 and a molecular weight of 474.60 g/mol. Its IUPAC name is (3R)-3-[[(2S)-1-(benzylamino)-3-naphthalen-2-yl-1-oxopropan-2-yl]carbamoyl]octanoic acid.
| Compound Name | (3R)-3-[[(2S)-1-(benzylamino)-3-naphthalen-2-yl-1-oxopropan-2-yl]carbamoyl]octanoic acid |
|---|---|
| PubChem CID | 69486465 |
| Molecular Formula | C29H34N2O4 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | (3R)-3-[[(2S)-1-(benzylamino)-3-naphthalen-2-yl-1-oxopropan-2-yl]carbamoyl]octanoic acid |
| SMILES | CCCCC[C@H](CC(=O)O)C(=O)N[C@@H](Cc1ccc2ccccc2c1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C29H34N2O4/c1-2-3-5-14-25(19-27(32)33)28(34)31-26(29(35)30-20-21-10-6-4-7-11-21)18-22-15-16-23-12-8-9-13-24(23)17-22/h4,6-13,15-17,25-26H,2-3,5,14,18-20H2,1H3,(H,30,35)(H,31,34)(H,32,33)/t25-,26+/m1/s1 |
| InChIKey | WLFUBLPCGRFYJF-FTJBHMTQSA-N |
| XLogP | 4.85 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|