C27H45N3O5 — CID 10163529
(3S)-3-[[(2R)-1-[3-(dimethylamino)propylamino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamoyl]dodecanoic acid (PubChem CID 10163529) has the molecular formula C27H45N3O5 and a molecular weight of 491.67 g/mol. Its IUPAC name is (3S)-3-[[(2R)-1-[3-(dimethylamino)propylamino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamoyl]dodecanoic acid.
| Compound Name | (3S)-3-[[(2R)-1-[3-(dimethylamino)propylamino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamoyl]dodecanoic acid |
|---|---|
| PubChem CID | 10163529 |
| Molecular Formula | C27H45N3O5 |
| Molecular Weight | 491.67 g/mol |
| Exact Mass | 491.34 |
| IUPAC Name | (3S)-3-[[(2R)-1-[3-(dimethylamino)propylamino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamoyl]dodecanoic acid |
| SMILES | CCCCCCCCC[C@@H](CC(=O)O)C(=O)N[C@H](Cc1ccc(O)cc1)C(=O)NCCCN(C)C |
| InChI | InChI=1S/C27H45N3O5/c1-4-5-6-7-8-9-10-12-22(20-25(32)33)26(34)29-24(19-21-13-15-23(31)16-14-21)27(35)28-17-11-18-30(2)3/h13-16,22,24,31H,4-12,17-20H2,1-3H3,(H,28,35)(H,29,34)(H,32,33)/t22-,24+/m0/s1 |
| InChIKey | XLWZQZJRZZVSFN-LADGPHEKSA-N |
| XLogP | 3.72 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.67 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|