C27H37N3O4 — CID 69463349
5-[[(2R)-1-[3-(dimethylamino)propylamino]-1-oxo-3-(4-phenylphenyl)propan-2-yl]amino]-3,3-dimethyl-5-oxopentanoic acid (PubChem CID 69463349) has the molecular formula C27H37N3O4 and a molecular weight of 467.61 g/mol. Its IUPAC name is 5-[[(2R)-1-[3-(dimethylamino)propylamino]-1-oxo-3-(4-phenylphenyl)propan-2-yl]amino]-3,3-dimethyl-5-oxopentanoic acid.
| Compound Name | 5-[[(2R)-1-[3-(dimethylamino)propylamino]-1-oxo-3-(4-phenylphenyl)propan-2-yl]amino]-3,3-dimethyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 69463349 |
| Molecular Formula | C27H37N3O4 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.28 |
| IUPAC Name | 5-[[(2R)-1-[3-(dimethylamino)propylamino]-1-oxo-3-(4-phenylphenyl)propan-2-yl]amino]-3,3-dimethyl-5-oxopentanoic acid |
| SMILES | CN(C)CCCNC(=O)[C@@H](Cc1ccc(-c2ccccc2)cc1)NC(=O)CC(C)(C)CC(=O)O |
| InChI | InChI=1S/C27H37N3O4/c1-27(2,19-25(32)33)18-24(31)29-23(26(34)28-15-8-16-30(3)4)17-20-11-13-22(14-12-20)21-9-6-5-7-10-21/h5-7,9-14,23H,8,15-19H2,1-4H3,(H,28,34)(H,29,31)(H,32,33)/t23-/m1/s1 |
| InChIKey | BVXBOBBOXQDDCK-HSZRJFAPSA-N |
| XLogP | 3.34 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|