C23H38Cl2N4O3 — CID 10972999
tert-butyl N-[(2S)-3-[4-[bis(2-chloroethyl)amino]phenyl]-1-[3-(dimethylamino)propylamino]-1-oxopropan-2-yl]carbamate (PubChem CID 10972999) has the molecular formula C23H38Cl2N4O3 and a molecular weight of 489.49 g/mol. Its IUPAC name is tert-butyl N-[(2S)-3-[4-[bis(2-chloroethyl)amino]phenyl]-1-[3-(dimethylamino)propylamino]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-3-[4-[bis(2-chloroethyl)amino]phenyl]-1-[3-(dimethylamino)propylamino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 10972999 |
| Molecular Formula | C23H38Cl2N4O3 |
| Molecular Weight | 489.49 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | tert-butyl N-[(2S)-3-[4-[bis(2-chloroethyl)amino]phenyl]-1-[3-(dimethylamino)propylamino]-1-oxopropan-2-yl]carbamate |
| SMILES | CN(C)CCCNC(=O)[C@H](Cc1ccc(N(CCCl)CCCl)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H38Cl2N4O3/c1-23(2,3)32-22(31)27-20(21(30)26-13-6-14-28(4)5)17-18-7-9-19(10-8-18)29(15-11-24)16-12-25/h7-10,20H,6,11-17H2,1-5H3,(H,26,30)(H,27,31)/t20-/m0/s1 |
| InChIKey | ZBAYXRVBUCVCAI-FQEVSTJZSA-N |
| XLogP | 3.47 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.49 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|