C16H22BrClN2O3 — CID 169042746
tert-butyl N-[(2S)-1-(2-bromoethylamino)-3-(4-chlorophenyl)-1-oxopropan-2-yl]carbamate (PubChem CID 169042746) has the molecular formula C16H22BrClN2O3 and a molecular weight of 405.72 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-(2-bromoethylamino)-3-(4-chlorophenyl)-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-(2-bromoethylamino)-3-(4-chlorophenyl)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 169042746 |
| Molecular Formula | C16H22BrClN2O3 |
| Molecular Weight | 405.72 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | tert-butyl N-[(2S)-1-(2-bromoethylamino)-3-(4-chlorophenyl)-1-oxopropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccc(Cl)cc1)C(=O)NCCBr |
| InChI | InChI=1S/C16H22BrClN2O3/c1-16(2,3)23-15(22)20-13(14(21)19-9-8-17)10-11-4-6-12(18)7-5-11/h4-7,13H,8-10H2,1-3H3,(H,19,21)(H,20,22)/t13-/m0/s1 |
| InChIKey | QZGLXMKLKGHTJS-ZDUSSCGKSA-N |
| XLogP | 3.29 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.72 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|