C16H19Cl4NO4 — CID 135078437
2,2,2-trichloroethyl (2R)-3-(4-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 135078437) has the molecular formula C16H19Cl4NO4 and a molecular weight of 431.14 g/mol. Its IUPAC name is 2,2,2-trichloroethyl (2R)-3-(4-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | 2,2,2-trichloroethyl (2R)-3-(4-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 135078437 |
| Molecular Formula | C16H19Cl4NO4 |
| Molecular Weight | 431.14 g/mol |
| Exact Mass | 429.01 |
| IUPAC Name | 2,2,2-trichloroethyl (2R)-3-(4-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | CC(C)(C)OC(=O)N[C@H](Cc1ccc(Cl)cc1)C(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H19Cl4NO4/c1-15(2,3)25-14(23)21-12(13(22)24-9-16(18,19)20)8-10-4-6-11(17)7-5-10/h4-7,12H,8-9H2,1-3H3,(H,21,23)/t12-/m1/s1 |
| InChIKey | ZZRDBAFPWMVXLV-GFCCVEGCSA-N |
| XLogP | 4.69 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.14 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|