C22H27ClN4O5 — CID 71054127
tert-butyl N-[(2R)-3-(4-chlorophenyl)-1-[2-(2-nitroanilino)ethylamino]-1-oxopropan-2-yl]carbamate (PubChem CID 71054127) has the molecular formula C22H27ClN4O5 and a molecular weight of 462.93 g/mol. Its IUPAC name is tert-butyl N-[(2R)-3-(4-chlorophenyl)-1-[2-(2-nitroanilino)ethylamino]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-3-(4-chlorophenyl)-1-[2-(2-nitroanilino)ethylamino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 71054127 |
| Molecular Formula | C22H27ClN4O5 |
| Molecular Weight | 462.93 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | tert-butyl N-[(2R)-3-(4-chlorophenyl)-1-[2-(2-nitroanilino)ethylamino]-1-oxopropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](Cc1ccc(Cl)cc1)C(=O)NCCNc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H27ClN4O5/c1-22(2,3)32-21(29)26-18(14-15-8-10-16(23)11-9-15)20(28)25-13-12-24-17-6-4-5-7-19(17)27(30)31/h4-11,18,24H,12-14H2,1-3H3,(H,25,28)(H,26,29)/t18-/m1/s1 |
| InChIKey | BMNOCETXCXSKQE-GOSISDBHSA-N |
| XLogP | 3.91 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.93 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|