C23H39Cl2N3O10P2 — CID 86747734
[5-[[(2S)-3-[4-[bis(2-chloroethyl)amino]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-1-hydroxy-1-phosphonopentyl]phosphonic acid (PubChem CID 86747734) has the molecular formula C23H39Cl2N3O10P2 and a molecular weight of 650.43 g/mol. Its IUPAC name is [5-[[(2S)-3-[4-[bis(2-chloroethyl)amino]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-1-hydroxy-1-phosphonopentyl]phosphonic acid.
| Compound Name | [5-[[(2S)-3-[4-[bis(2-chloroethyl)amino]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-1-hydroxy-1-phosphonopentyl]phosphonic acid |
|---|---|
| PubChem CID | 86747734 |
| Molecular Formula | C23H39Cl2N3O10P2 |
| Molecular Weight | 650.43 g/mol |
| Exact Mass | 649.15 |
| IUPAC Name | [5-[[(2S)-3-[4-[bis(2-chloroethyl)amino]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-1-hydroxy-1-phosphonopentyl]phosphonic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccc(N(CCCl)CCCl)cc1)C(=O)NCCCCC(O)(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C23H39Cl2N3O10P2/c1-22(2,3)38-21(30)27-19(16-17-6-8-18(9-7-17)28(14-11-24)15-12-25)20(29)26-13-5-4-10-23(31,39(32,33)34)40(35,36)37/h6-9,19,31H,4-5,10-16H2,1-3H3,(H,26,29)(H,27,30)(H2,32,33,34)(H2,35,36,37)/t19-/m0/s1 |
| InChIKey | LNHLTQVORMHCGU-IBGZPJMESA-N |
| XLogP | 2.69 |
| TPSA | 205.96 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.43 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|