C17H30Cl3N3O8P2 — CID 86747735
[4-[[(2S)-2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoyl]amino]-1-hydroxy-1-phosphonobutyl]phosphonic acid;hydrochloride (PubChem CID 86747735) has the molecular formula C17H30Cl3N3O8P2 and a molecular weight of 572.75 g/mol. Its IUPAC name is [4-[[(2S)-2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoyl]amino]-1-hydroxy-1-phosphonobutyl]phosphonic acid;hydrochloride.
| Compound Name | [4-[[(2S)-2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoyl]amino]-1-hydroxy-1-phosphonobutyl]phosphonic acid;hydrochloride |
|---|---|
| PubChem CID | 86747735 |
| Molecular Formula | C17H30Cl3N3O8P2 |
| Molecular Weight | 572.75 g/mol |
| Exact Mass | 571.06 |
| IUPAC Name | [4-[[(2S)-2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoyl]amino]-1-hydroxy-1-phosphonobutyl]phosphonic acid;hydrochloride |
| SMILES | Cl.N[C@@H](Cc1ccc(N(CCCl)CCCl)cc1)C(=O)NCCCC(O)(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C17H29Cl2N3O8P2.ClH/c18-7-10-22(11-8-19)14-4-2-13(3-5-14)12-15(20)16(23)21-9-1-6-17(24,31(25,26)27)32(28,29)30;/h2-5,15,24H,1,6-12,20H2,(H,21,23)(H2,25,26,27)(H2,28,29,30);1H/t15-;/m0./s1 |
| InChIKey | WXHUMDUCZVYWRX-RSAXXLAASA-N |
| XLogP | 1.16 |
| TPSA | 193.65 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.75 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|