C16H25Cl3N2O2 — CID 21120343
propan-2-yl (2S)-2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoate;hydrochloride (PubChem CID 21120343) has the molecular formula C16H25Cl3N2O2 and a molecular weight of 383.75 g/mol. Its IUPAC name is propan-2-yl (2S)-2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoate;hydrochloride.
| Compound Name | propan-2-yl (2S)-2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoate;hydrochloride |
|---|---|
| PubChem CID | 21120343 |
| Molecular Formula | C16H25Cl3N2O2 |
| Molecular Weight | 383.75 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | propan-2-yl (2S)-2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoate;hydrochloride |
| SMILES | CC(C)OC(=O)[C@@H](N)Cc1ccc(N(CCCl)CCCl)cc1.Cl |
| InChI | InChI=1S/C16H24Cl2N2O2.ClH/c1-12(2)22-16(21)15(19)11-13-3-5-14(6-4-13)20(9-7-17)10-8-18;/h3-6,12,15H,7-11,19H2,1-2H3;1H/t15-;/m0./s1 |
| InChIKey | FYIGBSZOZZHKIY-RSAXXLAASA-N |
| XLogP | 3.21 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.75 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|