C14H20Cl2N2O2S — CID 21139732
(2R)-2-amino-3-[[4-[bis(2-chloroethyl)amino]phenyl]methylsulfanyl]propanoic acid (PubChem CID 21139732) has the molecular formula C14H20Cl2N2O2S and a molecular weight of 351.30 g/mol. Its IUPAC name is (2R)-2-amino-3-[[4-[bis(2-chloroethyl)amino]phenyl]methylsulfanyl]propanoic acid.
| Compound Name | (2R)-2-amino-3-[[4-[bis(2-chloroethyl)amino]phenyl]methylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 21139732 |
| Molecular Formula | C14H20Cl2N2O2S |
| Molecular Weight | 351.30 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | (2R)-2-amino-3-[[4-[bis(2-chloroethyl)amino]phenyl]methylsulfanyl]propanoic acid |
| SMILES | N[C@@H](CSCc1ccc(N(CCCl)CCCl)cc1)C(=O)O |
| InChI | InChI=1S/C14H20Cl2N2O2S/c15-5-7-18(8-6-16)12-3-1-11(2-4-12)9-21-10-13(17)14(19)20/h1-4,13H,5-10,17H2,(H,19,20)/t13-/m0/s1 |
| InChIKey | JBBJXJJIYKNJFV-ZDUSSCGKSA-N |
| XLogP | 2.62 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.30 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|