C27H37Cl4N3O4 — CID 66967878
(2S)-2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoic acid;4-[4-[bis(2-chloroethyl)amino]phenyl]butanoic acid (PubChem CID 66967878) has the molecular formula C27H37Cl4N3O4 and a molecular weight of 609.42 g/mol. Its IUPAC name is (2S)-2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoic acid;4-[4-[bis(2-chloroethyl)amino]phenyl]butanoic acid.
| Compound Name | (2S)-2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoic acid;4-[4-[bis(2-chloroethyl)amino]phenyl]butanoic acid |
|---|---|
| PubChem CID | 66967878 |
| Molecular Formula | C27H37Cl4N3O4 |
| Molecular Weight | 609.42 g/mol |
| Exact Mass | 607.15 |
| IUPAC Name | (2S)-2-amino-3-[4-[bis(2-chloroethyl)amino]phenyl]propanoic acid;4-[4-[bis(2-chloroethyl)amino]phenyl]butanoic acid |
| SMILES | N[C@@H](Cc1ccc(N(CCCl)CCCl)cc1)C(=O)O.O=C(O)CCCc1ccc(N(CCCl)CCCl)cc1 |
| InChI | InChI=1S/C14H19Cl2NO2.C13H18Cl2N2O2/c15-8-10-17(11-9-16)13-6-4-12(5-7-13)2-1-3-14(18)19;14-5-7-17(8-6-15)11-3-1-10(2-4-11)9-12(16)13(18)19/h4-7H,1-3,8-11H2,(H,18,19);1-4,12H,5-9,16H2,(H,18,19)/t;12-/m.0/s1 |
| InChIKey | SFCKRDFIISVZHP-WKEFIFSLSA-N |
| XLogP | 5.30 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.42 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|