C24H31Cl2NO4 — CID 175046980
4-[4-[bis(2-chloroethyl)amino]phenyl]butanoic acid;2-phenylbutanoic acid (PubChem CID 175046980) has the molecular formula C24H31Cl2NO4 and a molecular weight of 468.42 g/mol. Its IUPAC name is 4-[4-[bis(2-chloroethyl)amino]phenyl]butanoic acid;2-phenylbutanoic acid.
| Compound Name | 4-[4-[bis(2-chloroethyl)amino]phenyl]butanoic acid;2-phenylbutanoic acid |
|---|---|
| PubChem CID | 175046980 |
| Molecular Formula | C24H31Cl2NO4 |
| Molecular Weight | 468.42 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | 4-[4-[bis(2-chloroethyl)amino]phenyl]butanoic acid;2-phenylbutanoic acid |
| SMILES | CCC(C(=O)O)c1ccccc1.O=C(O)CCCc1ccc(N(CCCl)CCCl)cc1 |
| InChI | InChI=1S/C14H19Cl2NO2.C10H12O2/c15-8-10-17(11-9-16)13-6-4-12(5-7-13)2-1-3-14(18)19;1-2-9(10(11)12)8-6-4-3-5-7-8/h4-7H,1-3,8-11H2,(H,18,19);3-7,9H,2H2,1H3,(H,11,12) |
| InChIKey | KBEBPZLOMCQXFH-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.42 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|